Spectroscopy Standards
eMolecules 495-69-2 | Hippuric acid | Ambeed | MFCD00002692 | 179.175 | C9H9NO3 | 98.000 | OC(=O)CNC(=O)c1ccccc1 | 25g | 552653888
Hippuric acid | Ambeed | 495-69-2 | MFCD00002692 | 179.175 | C9H9NO3 | 98.000 | OC(=O)CNC(=O)c1ccccc1 | 25g | 552653888
CCCCNC(=O)OCc1ccccc1 | 1g | 490565170](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502420838.PNG-250.jpg)
eMolecules 27894-50-4 | H-Lys(Z)-OMe??HCl | Ambeed | MFCD00034846 | 330.810 | C15H23ClN2O4 | 98.000 | Cl.COC(=O)[C@@H](N)CCCCNC(=O)OCc1ccccc1 | 1g | 490565170
H-Lys(Z)-OMe??HCl | Ambeed | 27894-50-4 | MFCD00034846 | 330.810 | C15H23ClN2O4 | 98.000 | Cl.COC(=O)[C@@H](N)CCCCNC(=O)OCc1ccccc1 | 1g | 490565170
eMolecules 65872-41-5 | Cefepime Related Compound D | Ambeed201.200 | C6H7N3O3S | 97.000 | CON=C(C(O)=O)c1csc(N)n1 | 5g | 552618090
Cefepime Related Compound D | Ambeed | 65872-41-5201.200 | C6H7N3O3S | 97.000 | CON=C(C(O)=O)c1csc(N)n1 | 5g | 552618090
![eMolecules 926257-28-5 | 2-HYDROXY-N-[4-(TRIFLUOROMETHYL)PHENYL]ACETAMIDE | AstaTech | MFCD08442555 | 219.163 | C9H8F3NO2 | 95.000 | OCC(=O)Nc1ccc(cc1)C(F)(F)F | 0.25g | 552880630](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502480816.JPG-250.jpg)
eMolecules 926257-28-5 | 2-HYDROXY-N-[4-(TRIFLUOROMETHYL)PHENYL]ACETAMIDE | AstaTech | MFCD08442555 | 219.163 | C9H8F3NO2 | 95.000 | OCC(=O)Nc1ccc(cc1)C(F)(F)F | 0.25g | 552880630
2-HYDROXY-N-[4-(TRIFLUOROMETHYL)PHENYL]ACETAMIDE | AstaTech | 926257-28-5 | MFCD08442555 | 219.163 | C9H8F3NO2 | 95.000 | OCC(=O)Nc1ccc(cc1)C(F)(F)F | 0.25g | 552880630
OCC1c2ccccc2-c2ccccc12)C(O)=O | 25g | 552585968](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502432103.PNG-250.jpg)
eMolecules 71989-20-3 | Fmoc-Gln-OH | Ambeed368.389 | C20H20N2O5 | 97.000 | NC(=O)CC[C@H](NC(=O)OCC1c2ccccc2-c2ccccc12)C(O)=O | 25g | 552585968
Fmoc-Gln-OH | Ambeed | 71989-20-3368.389 | C20H20N2O5 | 97.000 | NC(=O)CC[C@H](NC(=O)OCC1c2ccccc2-c2ccccc12)C(O)=O | 25g | 552585968
eMolecules 850568-30-8 | Ambeed | (4-((45-Dihydrothiazol-2-yl)carbamoyl)phenyl)boronic acid | 100mg | 714088018 | A704225 | MFCD06659881 | 250.08 | C10H11BN2O3S
Ambeed | (4-((45-Dihydrothiazol-2-yl)carbamoyl)phenyl)boronic acid | 100mg | 714088018 | A704225 | 850568-30-8 | MFCD06659881 | 250.080 | C10H11BN2O3S
Cn1cnc2c(N)ncnc12)OCOC(=O)OC(C)C | 10mg | 650568200](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502425625.JPG-250.jpg)
eMolecules 201341-05-1 | Tenofovir Disoproxil | Ambeed | MFCD00952920 | 519.448 | C19H30N5O10P | 98.000 | CC(C)OC(=O)OCOP(=O)(CO[C@H](C)Cn1cnc2c(N)ncnc12)OCOC(=O)OC(C)C | 10mg | 650568200
Tenofovir Disoproxil | Ambeed | 201341-05-1 | MFCD00952920 | 519.448 | C19H30N5O10P | 98.000 | CC(C)OC(=O)OCOP(=O)(CO[C@H](C)Cn1cnc2c(N)ncnc12)OCOC(=O)OC(C)C | 10mg | 650568200
Enterprise Technology Solutions Maxtec MAX-13 Oxygen Cell is an FiO2 (Fraction of Inspired Oxygen) Sensor
The Maxtec MAX-13 Oxygen Cell is an FiO2 (Fraction of Inspired Oxygen) Sensor that is primarily used with ventilator machines. Check below for specific compatibility information.#G0-030 (Generic Equivalent):Response Time: Less than 12 seconds.Connector Type: 3.5 mm Mono Jack.Compatible With:BMD (Bio-Med Devices): M-10, M-2.Bird: 6400, 8400, VIP, Sentry.Covidien-Puritan Bennett: 7820, PB 850.Datex-Ohmeda: 7200, Engstrom Elvira, Engstrom Erica.MSA: MiniOx III.Respironics: Esprit Lifecare.
eMolecules 3470-54-0 | Ambeed | 5-Aminoindan-1-one | 250mg | 552616338 | A174249 | MFCD00099466 | 147.177 | C9H9NO
Ambeed | 2-(4-Fluoro-3-methoxyphenyl)acetonitrile | 250mg | 506390645 | A382586 | 850565-37-6 | MFCD09038465 | 165.167 | C9H8FNO
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 21312-10-7 | Ambeed | N-(4-(N-(5-Methylisoxazol-3-yl)sulfamoyl)phenyl)acetamide | 100mg | 632172361 | A134633 | MFCD00205417 | 295.31 | C12H13N3O4S
Ambeed | 45-Difluoro-2-methoxybenzoic acid | 1g | 592397283 | A215993 | 425702-18-7 | MFCD06660196 | 188.130 | C8H6F2O3
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 63480-11-5 | AstaTech | 4-METHYL-ISATOIC ANHYDRIDE | 1g | 200611504 | 59402 | 97 | MFCD03426400 | 177.159 | C9H7NO3
AstaTech | 4-METHYL-ISATOIC ANHYDRIDE | 1g | 200611504 | 59402 | 97.000 | 63480-11-5 | MFCD03426400 | 177.159 | C9H7NO3
C(=O)OC(C)(C)C)c1ccccc1 | 500mg | 599147737](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502480563.JPG-250.jpg)
eMolecules 108787-51-5 | (2R,3S)-2-Amino-3-phenyl-butyric acid tert-butyl ester | J&W PharmLab LLC235.327 | C14H21NO2 | 96.000 | C[C@H]([C@@H](N)C(=O)OC(C)(C)C)c1ccccc1 | 500mg | 599147737
(2R,3S)-2-Amino-3-phenyl-butyric acid tert-butyl ester | J&W PharmLab LLC | 108787-51-5235.327 | C14H21NO2 | 96.000 | C[C@H]([C@@H](N)C(=O)OC(C)(C)C)c1ccccc1 | 500mg | 599147737
Cayman Chemical HU331 Analytical Reference Sta
An analytical reference standard categorized as an oxidative degradation product of CBD; intended for research and forensic applications
eMolecules 2313526-86-0 | VU6012962 | Ambeed448.402 | C21H19F3N4O4 | 98.000 | COc1cc(ccc1OCC1CC1)C(=O)Nc1cc(OC(F)(F)F)ccc1-n1cncn1 | 1mg | 598441537
VU6012962 | Ambeed | 2313526-86-0448.402 | C21H19F3N4O4 | 98.000 | COc1cc(ccc1OCC1CC1)C(=O)Nc1cc(OC(F)(F)F)ccc1-n1cncn1 | 1mg | 598441537
eMolecules 2230009-48-8 | Medchem Express | Alogabat | 5mg | 686240419 | HY-132806 | 409.446 | C21H23N5O4
Ambeed | 8-Benzyl-1-oxa-38-diazaspiro[4.5]decan-2-one | 250mg | 666599522 | A574738 | 5053-14-5 | MFCD01710744 | 246.310 | C14H18N2O2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>